C11H21N3O — CID 74881814
N-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 74881814) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | N-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 74881814 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-tert-butyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CC2CCNC2C1 |
| InChI | InChI=1S/C11H21N3O/c1-11(2,3)13-10(15)14-6-8-4-5-12-9(8)7-14/h8-9,12H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | KIDDIOMKPPMKLF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |