C17H27N3O2 — CID 162628328
1-[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-(1H-pyrazol-4-yl)butan-1-one (PubChem CID 162628328) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-(1H-pyrazol-4-yl)butan-1-one.
| Compound Name | 1-[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-(1H-pyrazol-4-yl)butan-1-one |
|---|---|
| PubChem CID | 162628328 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 1-[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-4-(1H-pyrazol-4-yl)butan-1-one |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(C(=O)CCCc3cn[nH]c3)C[C@H]21 |
| InChI | InChI=1S/C17H27N3O2/c1-2-17(22)8-4-6-14-11-20(12-15(14)17)16(21)7-3-5-13-9-18-19-10-13/h9-10,14-15,22H,2-8,11-12H2,1H3,(H,18,19)/t14-,15+,17-/m0/s1 |
| InChIKey | GIYCWBUFHSMXMJ-UXLLHSPISA-N |
| XLogP | 2.13 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |