C21H30N2O3 — CID 135097797
N-[3-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]phenyl]-2-methylpropanamide (PubChem CID 135097797) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is N-[3-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 135097797 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | N-[3-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindole-2-carbonyl]phenyl]-2-methylpropanamide |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(C(=O)c3cccc(NC(=O)C(C)C)c3)C[C@@H]21 |
| InChI | InChI=1S/C21H30N2O3/c1-4-21(26)10-6-8-16-12-23(13-18(16)21)20(25)15-7-5-9-17(11-15)22-19(24)14(2)3/h5,7,9,11,14,16,18,26H,4,6,8,10,12-13H2,1-3H3,(H,22,24)/t16-,18+,21-/m1/s1 |
| InChIKey | FUNWMBBPZKCROL-PLMTUMEDSA-N |
| XLogP | 3.29 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |