C24H30N4O3 — CID 54843283
2-methyl-N-[3-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]phenyl]propanamide (PubChem CID 54843283) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-methyl-N-[3-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]phenyl]propanamide.
| Compound Name | 2-methyl-N-[3-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 54843283 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-methyl-N-[3-[[2-[3-(piperidine-1-carbonyl)anilino]acetyl]amino]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1cccc(NC(=O)CNc2cccc(C(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C24H30N4O3/c1-17(2)23(30)27-21-11-7-10-20(15-21)26-22(29)16-25-19-9-6-8-18(14-19)24(31)28-12-4-3-5-13-28/h6-11,14-15,17,25H,3-5,12-13,16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | BCFKQJXRSKRIOR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |