C23H28N4O3 — CID 54833558
3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]-N-propan-2-ylbenzamide (PubChem CID 54833558) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 54833558 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cccc(NCC(=O)Nc2cccc(C(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-16(2)25-22(29)17-7-5-9-19(13-17)24-15-21(28)26-20-10-6-8-18(14-20)23(30)27-11-3-4-12-27/h5-10,13-14,16,24H,3-4,11-12,15H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | OSCFBXQFCDXDQO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |