C27H36N4O3 — CID 54841375
N-[3-[[2-[3-(azepane-1-carbonyl)anilino]acetyl]amino]phenyl]hexanamide (PubChem CID 54841375) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[3-[[2-[3-(azepane-1-carbonyl)anilino]acetyl]amino]phenyl]hexanamide.
| Compound Name | N-[3-[[2-[3-(azepane-1-carbonyl)anilino]acetyl]amino]phenyl]hexanamide |
|---|---|
| PubChem CID | 54841375 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | N-[3-[[2-[3-(azepane-1-carbonyl)anilino]acetyl]amino]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(NC(=O)CNc2cccc(C(=O)N3CCCCCC3)c2)c1 |
| InChI | InChI=1S/C27H36N4O3/c1-2-3-6-15-25(32)29-23-13-10-14-24(19-23)30-26(33)20-28-22-12-9-11-21(18-22)27(34)31-16-7-4-5-8-17-31/h9-14,18-19,28H,2-8,15-17,20H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | XVLQKMVQACAOSX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|