C26H35N3O3 — CID 54843402
N-(4-hexoxyphenyl)-2-[3-(piperidine-1-carbonyl)anilino]acetamide (PubChem CID 54843402) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is N-(4-hexoxyphenyl)-2-[3-(piperidine-1-carbonyl)anilino]acetamide.
| Compound Name | N-(4-hexoxyphenyl)-2-[3-(piperidine-1-carbonyl)anilino]acetamide |
|---|---|
| PubChem CID | 54843402 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | N-(4-hexoxyphenyl)-2-[3-(piperidine-1-carbonyl)anilino]acetamide |
| SMILES | CCCCCCOc1ccc(NC(=O)CNc2cccc(C(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C26H35N3O3/c1-2-3-4-8-18-32-24-14-12-22(13-15-24)28-25(30)20-27-23-11-9-10-21(19-23)26(31)29-16-6-5-7-17-29/h9-15,19,27H,2-8,16-18,20H2,1H3,(H,28,30) |
| InChIKey | HFRQQZACUQCWIK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|