C19H28N2O4 — CID 131949645
N-[3-[4-(2-methoxyethoxy)piperidine-1-carbonyl]phenyl]-2-methylpropanamide (PubChem CID 131949645) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-[3-[4-(2-methoxyethoxy)piperidine-1-carbonyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[4-(2-methoxyethoxy)piperidine-1-carbonyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 131949645 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[3-[4-(2-methoxyethoxy)piperidine-1-carbonyl]phenyl]-2-methylpropanamide |
| SMILES | COCCOC1CCN(C(=O)c2cccc(NC(=O)C(C)C)c2)CC1 |
| InChI | InChI=1S/C19H28N2O4/c1-14(2)18(22)20-16-6-4-5-15(13-16)19(23)21-9-7-17(8-10-21)25-12-11-24-3/h4-6,13-14,17H,7-12H2,1-3H3,(H,20,22) |
| InChIKey | ITQMIMUUGHGITG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|