C21H31N3O3 — CID 55697566
1-(3-cyclohexyloxypropyl)-3-[3-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 55697566) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-3-[3-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-(3-cyclohexyloxypropyl)-3-[3-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 55697566 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-3-[3-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | O=C(NCCCOC1CCCCC1)Nc1cccc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H31N3O3/c25-20(24-13-4-5-14-24)17-8-6-9-18(16-17)23-21(26)22-12-7-15-27-19-10-2-1-3-11-19/h6,8-9,16,19H,1-5,7,10-15H2,(H2,22,23,26) |
| InChIKey | MQEPSTYKKOWTDB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|