C17H21N3O4 — CID 48951773
1-(3-cyclopentyloxypropyl)-3-(1,3-dioxoisoindol-5-yl)urea (PubChem CID 48951773) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-(3-cyclopentyloxypropyl)-3-(1,3-dioxoisoindol-5-yl)urea.
| Compound Name | 1-(3-cyclopentyloxypropyl)-3-(1,3-dioxoisoindol-5-yl)urea |
|---|---|
| PubChem CID | 48951773 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(3-cyclopentyloxypropyl)-3-(1,3-dioxoisoindol-5-yl)urea |
| SMILES | O=C(NCCCOC1CCCC1)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C17H21N3O4/c21-15-13-7-6-11(10-14(13)16(22)20-15)19-17(23)18-8-3-9-24-12-4-1-2-5-12/h6-7,10,12H,1-5,8-9H2,(H2,18,19,23)(H,20,21,22) |
| InChIKey | GZXPIQBYGKQPGF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|