C17H21N3O5 — CID 59414698
2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]ethyl 2,2-dimethylbutanoate (PubChem CID 59414698) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59414698 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C17H21N3O5/c1-4-17(2,3)15(23)25-8-7-18-16(24)19-10-5-6-11-12(9-10)14(22)20-13(11)21/h5-6,9H,4,7-8H2,1-3H3,(H2,18,19,24)(H,20,21,22) |
| InChIKey | KZWYXFHMGPAUFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|