C13H13N3O5 — CID 61265736
2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]-2-methylpropanoic acid (PubChem CID 61265736) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61265736 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)Nc1ccc2c(c1)C(=O)NC2=O)C(=O)O |
| InChI | InChI=1S/C13H13N3O5/c1-13(2,11(19)20)16-12(21)14-6-3-4-7-8(5-6)10(18)15-9(7)17/h3-5H,1-2H3,(H,19,20)(H2,14,16,21)(H,15,17,18) |
| InChIKey | JUEQTNSYHKKIRA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|