C17H14BrN3O3 — CID 10134845
1-[1-(4-bromophenyl)ethyl]-3-(1,3-dioxoisoindol-5-yl)urea (PubChem CID 10134845) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)ethyl]-3-(1,3-dioxoisoindol-5-yl)urea.
| Compound Name | 1-[1-(4-bromophenyl)ethyl]-3-(1,3-dioxoisoindol-5-yl)urea |
|---|---|
| PubChem CID | 10134845 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1-[1-(4-bromophenyl)ethyl]-3-(1,3-dioxoisoindol-5-yl)urea |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)C(=O)NC2=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrN3O3/c1-9(10-2-4-11(18)5-3-10)19-17(24)20-12-6-7-13-14(8-12)16(23)21-15(13)22/h2-9H,1H3,(H2,19,20,24)(H,21,22,23) |
| InChIKey | LQLFFKNEKKAESD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|