C21H25N3O3 — CID 91348312
butan-2-ylbenzene;1-(1,3-dioxoisoindol-5-yl)-3-ethylurea (PubChem CID 91348312) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is butan-2-ylbenzene;1-(1,3-dioxoisoindol-5-yl)-3-ethylurea.
| Compound Name | butan-2-ylbenzene;1-(1,3-dioxoisoindol-5-yl)-3-ethylurea |
|---|---|
| PubChem CID | 91348312 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | butan-2-ylbenzene;1-(1,3-dioxoisoindol-5-yl)-3-ethylurea |
| SMILES | CCC(C)c1ccccc1.CCNC(=O)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C11H11N3O3.C10H14/c1-2-12-11(17)13-6-3-4-7-8(5-6)10(16)14-9(7)15;1-3-9(2)10-7-5-4-6-8-10/h3-5H,2H2,1H3,(H2,12,13,17)(H,14,15,16);4-9H,3H2,1-2H3 |
| InChIKey | ZRGOGYGPBYBILK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|