C18H18N4O5S — CID 48803101
1-(1,3-dioxoisoindol-5-yl)-3-[1-[4-(methylsulfamoyl)phenyl]ethyl]urea (PubChem CID 48803101) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-5-yl)-3-[1-[4-(methylsulfamoyl)phenyl]ethyl]urea.
| Compound Name | 1-(1,3-dioxoisoindol-5-yl)-3-[1-[4-(methylsulfamoyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 48803101 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-(1,3-dioxoisoindol-5-yl)-3-[1-[4-(methylsulfamoyl)phenyl]ethyl]urea |
| SMILES | CNS(=O)(=O)c1ccc(C(C)NC(=O)Nc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C18H18N4O5S/c1-10(11-3-6-13(7-4-11)28(26,27)19-2)20-18(25)21-12-5-8-14-15(9-12)17(24)22-16(14)23/h3-10,19H,1-2H3,(H2,20,21,25)(H,22,23,24) |
| InChIKey | KHGYOHRTTGKGAH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|