C12H11N3O5 — CID 61192686
2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]propanoic acid (PubChem CID 61192686) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]propanoic acid.
| Compound Name | 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 61192686 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-5-yl)carbamoylamino]propanoic acid |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)C(=O)NC2=O)C(=O)O |
| InChI | InChI=1S/C12H11N3O5/c1-5(11(18)19)13-12(20)14-6-2-3-7-8(4-6)10(17)15-9(7)16/h2-5H,1H3,(H,18,19)(H2,13,14,20)(H,15,16,17) |
| InChIKey | ZZWAZRTVRWLKCF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|