C12H12ClN3O3 — CID 61266932
2-[(3-chloro-4-cyanophenyl)carbamoylamino]-2-methylpropanoic acid (PubChem CID 61266932) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 2-[(3-chloro-4-cyanophenyl)carbamoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[(3-chloro-4-cyanophenyl)carbamoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61266932 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-[(3-chloro-4-cyanophenyl)carbamoylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)Nc1ccc(C#N)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H12ClN3O3/c1-12(2,10(17)18)16-11(19)15-8-4-3-7(6-14)9(13)5-8/h3-5H,1-2H3,(H,17,18)(H2,15,16,19) |
| InChIKey | UYLSCATWPFZWFK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |