C16H13N3O3 — CID 43826072
2-(4-aminophenyl)-N-(1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 43826072) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-(4-aminophenyl)-N-(1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 43826072 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(4-aminophenyl)-N-(1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | Nc1ccc(CC(=O)Nc2ccc3c(c2)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C16H13N3O3/c17-10-3-1-9(2-4-10)7-14(20)18-11-5-6-12-13(8-11)16(22)19-15(12)21/h1-6,8H,7,17H2,(H,18,20)(H,19,21,22) |
| InChIKey | SWNNJIDXSAGVJP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|