C18H29N5O5 — CID 137304335
2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl 4-carbamoyl-2,2,4-trimethylhexanoate (PubChem CID 137304335) has the molecular formula C18H29N5O5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl 4-carbamoyl-2,2,4-trimethylhexanoate.
| Compound Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl 4-carbamoyl-2,2,4-trimethylhexanoate |
|---|---|
| PubChem CID | 137304335 |
| Molecular Formula | C18H29N5O5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyl 4-carbamoyl-2,2,4-trimethylhexanoate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCNC(=O)Nc1nc(C)cc(=O)[nH]1)C(N)=O |
| InChI | InChI=1S/C18H29N5O5/c1-6-18(5,13(19)25)10-17(3,4)14(26)28-8-7-20-16(27)23-15-21-11(2)9-12(24)22-15/h9H,6-8,10H2,1-5H3,(H2,19,25)(H3,20,21,22,23,24,27) |
| InChIKey | ZHHBGPFSFCXTOA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|