C11H16N4O4 — CID 135965731
[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl 2-methylpropanoate (PubChem CID 135965731) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is [(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl 2-methylpropanoate.
| Compound Name | [(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 135965731 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]methyl 2-methylpropanoate |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCOC(=O)C(C)C)n1 |
| InChI | InChI=1S/C11H16N4O4/c1-6(2)9(17)19-5-12-11(18)15-10-13-7(3)4-8(16)14-10/h4,6H,5H2,1-3H3,(H3,12,13,14,15,16,18) |
| InChIKey | MKMRSVSNNACUKE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|