C19H30N4O6 — CID 137101979
ditert-butyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]pentanedioate (PubChem CID 137101979) has the molecular formula C19H30N4O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is ditert-butyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 137101979 |
| Molecular Formula | C19H30N4O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ditert-butyl 2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]pentanedioate |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NC(CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C19H30N4O6/c1-11-10-13(24)22-16(20-11)23-17(27)21-12(15(26)29-19(5,6)7)8-9-14(25)28-18(2,3)4/h10,12H,8-9H2,1-7H3,(H3,20,21,22,23,24,27) |
| InChIKey | HXBLABOLRQFENS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |