C16H26N4O4S2 — CID 161253841
tert-butyl 4-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyldisulfanyl]butanoate (PubChem CID 161253841) has the molecular formula C16H26N4O4S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyldisulfanyl]butanoate.
| Compound Name | tert-butyl 4-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyldisulfanyl]butanoate |
|---|---|
| PubChem CID | 161253841 |
| Molecular Formula | C16H26N4O4S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | tert-butyl 4-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]ethyldisulfanyl]butanoate |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCCSSCCCC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C16H26N4O4S2/c1-11-10-12(21)19-14(18-11)20-15(23)17-7-9-26-25-8-5-6-13(22)24-16(2,3)4/h10H,5-9H2,1-4H3,(H3,17,18,19,20,21,23) |
| InChIKey | RNLMFJWPUWTWJT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|