C18H33N7O3 — CID 136636053
1-[3-(dimethylamino)propyl]-3-[6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]urea (PubChem CID 136636053) has the molecular formula C18H33N7O3 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 136636053 |
| Molecular Formula | C18H33N7O3 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[6-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]hexyl]urea |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCCCCCCNC(=O)NCCCN(C)C)n1 |
| InChI | InChI=1S/C18H33N7O3/c1-14-13-15(26)23-16(22-14)24-18(28)21-10-7-5-4-6-9-19-17(27)20-11-8-12-25(2)3/h13H,4-12H2,1-3H3,(H2,19,20,27)(H3,21,22,23,24,26,28) |
| InChIKey | QYVZPRUMGNHQEC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|