C13H17N4O3Y- — CID 148507790
1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-(5-oxohept-6-enyl)urea;yttrium (PubChem CID 148507790) has the molecular formula C13H17N4O3Y- and a molecular weight of 366.21 g/mol. Its IUPAC name is 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-(5-oxohept-6-enyl)urea;yttrium.
| Compound Name | 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-(5-oxohept-6-enyl)urea;yttrium |
|---|---|
| PubChem CID | 148507790 |
| Molecular Formula | C13H17N4O3Y- |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-3-(5-oxohept-6-enyl)urea;yttrium |
| SMILES | C=[C-]C(=O)CCCCNC(=O)Nc1nc(C)cc(=O)[nH]1.[Y] |
| InChI | InChI=1S/C13H17N4O3.Y/c1-3-10(18)6-4-5-7-14-13(20)17-12-15-9(2)8-11(19)16-12;/h8H,1,4-7H2,2H3,(H3,14,15,16,17,19,20);/q-1; |
| InChIKey | SPLRCNBZDXYUJH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|