C15H24ClN7O4S — CID 141373564
O-[4-[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-4-oxobutyl] N-iminocarbamothioate;hydrochloride (PubChem CID 141373564) has the molecular formula C15H24ClN7O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is O-[4-[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-4-oxobutyl] N-iminocarbamothioate;hydrochloride.
| Compound Name | O-[4-[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-4-oxobutyl] N-iminocarbamothioate;hydrochloride |
|---|---|
| PubChem CID | 141373564 |
| Molecular Formula | C15H24ClN7O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | O-[4-[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoylamino]butylamino]-4-oxobutyl] N-iminocarbamothioate;hydrochloride |
| SMILES | Cl.[H]/N=N/C(=S)OCCCC(=O)NCCCCNC(=O)Nc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H23N7O4S.ClH/c1-10-9-12(24)20-13(19-10)21-14(25)18-7-3-2-6-17-11(23)5-4-8-26-15(27)22-16;/h9,16H,2-8H2,1H3,(H,17,23)(H3,18,19,20,21,24,25);1H/b22-16+; |
| InChIKey | IXODDBKZRPYEQJ-YHLMHSEJSA-N |
| XLogP | 1.63 |
| TPSA | 161.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|