C15H27N7O2S — CID 137031823
[4-[4-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methylamino]butylamino]-4-oxobutyl] carbamimidothioate (PubChem CID 137031823) has the molecular formula C15H27N7O2S and a molecular weight of 369.50 g/mol. Its IUPAC name is [4-[4-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methylamino]butylamino]-4-oxobutyl] carbamimidothioate.
| Compound Name | [4-[4-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methylamino]butylamino]-4-oxobutyl] carbamimidothioate |
|---|---|
| PubChem CID | 137031823 |
| Molecular Formula | C15H27N7O2S |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [4-[4-[[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]methylamino]butylamino]-4-oxobutyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCCC(=O)NCCCCNCNc1nc(C)cc(=O)[nH]1 |
| InChI | InChI=1S/C15H27N7O2S/c1-11-9-13(24)22-15(21-11)20-10-18-6-2-3-7-19-12(23)5-4-8-25-14(16)17/h9,18H,2-8,10H2,1H3,(H3,16,17)(H,19,23)(H2,20,21,22,24) |
| InChIKey | ICLYENSKOKEREC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 148.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|