C12H21N5O2 — CID 136662261
(2R)-2-amino-3-methyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]butanamide (PubChem CID 136662261) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2R)-2-amino-3-methyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]butanamide.
| Compound Name | (2R)-2-amino-3-methyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 136662261 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (2R)-2-amino-3-methyl-N-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)amino]ethyl]butanamide |
| SMILES | Cc1cc(=O)[nH]c(NCCNC(=O)[C@H](N)C(C)C)n1 |
| InChI | InChI=1S/C12H21N5O2/c1-7(2)10(13)11(19)14-4-5-15-12-16-8(3)6-9(18)17-12/h6-7,10H,4-5,13H2,1-3H3,(H,14,19)(H2,15,16,17,18)/t10-/m1/s1 |
| InChIKey | NTEXIHDOWAIJRH-SNVBAGLBSA-N |
| XLogP | -0.41 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|