C36H64N8O4 — CID 139249156
1-[5-methyl-2-(3-methylbutyl)hexyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea (PubChem CID 139249156) has the molecular formula C36H64N8O4 and a molecular weight of 672.96 g/mol. Its IUPAC name is 1-[5-methyl-2-(3-methylbutyl)hexyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea.
| Compound Name | 1-[5-methyl-2-(3-methylbutyl)hexyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 139249156 |
| Molecular Formula | C36H64N8O4 |
| Molecular Weight | 672.96 g/mol |
| Exact Mass | 672.51 |
| IUPAC Name | 1-[5-methyl-2-(3-methylbutyl)hexyl]-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCC(CCC(C)C)CCC(C)C)n1.Cc1cc(=O)[nH]c(NC(=O)NCC(CCC(C)C)CCC(C)C)n1 |
| InChI | InChI=1S/2C18H32N4O2/c2*1-12(2)6-8-15(9-7-13(3)4)11-19-18(24)22-17-20-14(5)10-16(23)21-17/h2*10,12-13,15H,6-9,11H2,1-5H3,(H3,19,20,21,22,23,24) |
| InChIKey | CFAXCUCANMSKJO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.96 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |