C14H14N4O4 — CID 166785590
benzyl N-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoyl]carbamate (PubChem CID 166785590) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is benzyl N-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoyl]carbamate.
| Compound Name | benzyl N-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 166785590 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | benzyl N-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)carbamoyl]carbamate |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C14H14N4O4/c1-9-7-11(19)16-12(15-9)17-13(20)18-14(21)22-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H3,15,16,17,18,19,20,21) |
| InChIKey | PSHGVEJADGGXHT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |