C16H21ClF2N2O3 — CID 49111400
1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-cyclopentyloxypropyl)urea (PubChem CID 49111400) has the molecular formula C16H21ClF2N2O3 and a molecular weight of 362.80 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-cyclopentyloxypropyl)urea.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-cyclopentyloxypropyl)urea |
|---|---|
| PubChem CID | 49111400 |
| Molecular Formula | C16H21ClF2N2O3 |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3-cyclopentyloxypropyl)urea |
| SMILES | O=C(NCCCOC1CCCC1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H21ClF2N2O3/c17-13-10-11(6-7-14(13)24-15(18)19)21-16(22)20-8-3-9-23-12-4-1-2-5-12/h6-7,10,12,15H,1-5,8-9H2,(H2,20,21,22) |
| InChIKey | RJCNAEZGVJJCHP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|