C16H22BrClN2OS — CID 100699692
1-(4-bromo-3-chlorophenyl)-3-(3-cyclohexyloxypropyl)thiourea (PubChem CID 100699692) has the molecular formula C16H22BrClN2OS and a molecular weight of 405.79 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-(3-cyclohexyloxypropyl)thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-(3-cyclohexyloxypropyl)thiourea |
|---|---|
| PubChem CID | 100699692 |
| Molecular Formula | C16H22BrClN2OS |
| Molecular Weight | 405.79 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-(3-cyclohexyloxypropyl)thiourea |
| SMILES | S=C(NCCCOC1CCCCC1)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H22BrClN2OS/c17-14-8-7-12(11-15(14)18)20-16(22)19-9-4-10-21-13-5-2-1-3-6-13/h7-8,11,13H,1-6,9-10H2,(H2,19,20,22) |
| InChIKey | WOAJZCXHJAOJKW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|