C14H22F2N4O2 — CID 56795130
1-(3-cyclopentyloxypropyl)-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]urea (PubChem CID 56795130) has the molecular formula C14H22F2N4O2 and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-(3-cyclopentyloxypropyl)-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]urea.
| Compound Name | 1-(3-cyclopentyloxypropyl)-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 56795130 |
| Molecular Formula | C14H22F2N4O2 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1-(3-cyclopentyloxypropyl)-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]urea |
| SMILES | O=C(NCCCOC1CCCC1)Nc1cnn(CC(F)F)c1 |
| InChI | InChI=1S/C14H22F2N4O2/c15-13(16)10-20-9-11(8-18-20)19-14(21)17-6-3-7-22-12-4-1-2-5-12/h8-9,12-13H,1-7,10H2,(H2,17,19,21) |
| InChIKey | UPRLLWVSWLGTFC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|