C13H20F2N4O — CID 126780377
1-cyclohexyl-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1-methylurea (PubChem CID 126780377) has the molecular formula C13H20F2N4O and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1-methylurea.
| Compound Name | 1-cyclohexyl-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1-methylurea |
|---|---|
| PubChem CID | 126780377 |
| Molecular Formula | C13H20F2N4O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 1-cyclohexyl-3-[1-(2,2-difluoroethyl)pyrazol-4-yl]-1-methylurea |
| SMILES | CN(C(=O)Nc1cnn(CC(F)F)c1)C1CCCCC1 |
| InChI | InChI=1S/C13H20F2N4O/c1-18(11-5-3-2-4-6-11)13(20)17-10-7-16-19(8-10)9-12(14)15/h7-8,11-12H,2-6,9H2,1H3,(H,17,20) |
| InChIKey | ICHIJQJBWUSCCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |