C18H24ClF2N3O3 — CID 18225712
N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(cyclohexylcarbamoylamino)butanamide (PubChem CID 18225712) has the molecular formula C18H24ClF2N3O3 and a molecular weight of 403.86 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(cyclohexylcarbamoylamino)butanamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(cyclohexylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 18225712 |
| Molecular Formula | C18H24ClF2N3O3 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(cyclohexylcarbamoylamino)butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C18H24ClF2N3O3/c19-14-11-13(8-9-15(14)27-17(20)21)23-16(25)7-4-10-22-18(26)24-12-5-2-1-3-6-12/h8-9,11-12,17H,1-7,10H2,(H,23,25)(H2,22,24,26) |
| InChIKey | BYMCBDIGDCDROM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|