C19H27F2N3O3 — CID 18146757
4-(cyclohexylcarbamoylamino)-N-[[4-(difluoromethoxy)phenyl]methyl]butanamide (PubChem CID 18146757) has the molecular formula C19H27F2N3O3 and a molecular weight of 383.44 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[[4-(difluoromethoxy)phenyl]methyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[[4-(difluoromethoxy)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 18146757 |
| Molecular Formula | C19H27F2N3O3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[[4-(difluoromethoxy)phenyl]methyl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H27F2N3O3/c20-18(21)27-16-10-8-14(9-11-16)13-23-17(25)7-4-12-22-19(26)24-15-5-2-1-3-6-15/h8-11,15,18H,1-7,12-13H2,(H,23,25)(H2,22,24,26) |
| InChIKey | JJWAVMWRBROXQE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|