C13H15F2NO4 — CID 60941319
5-[[4-(difluoromethoxy)phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 60941319) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-(difluoromethoxy)phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60941319 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-[[4-(difluoromethoxy)phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H15F2NO4/c14-13(15)20-10-6-4-9(5-7-10)8-16-11(17)2-1-3-12(18)19/h4-7,13H,1-3,8H2,(H,16,17)(H,18,19) |
| InChIKey | FXWYTVIFIVUIIM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |