C20H28F2N2O2 — CID 95576076
2-[(2R)-2-cyclohexylpyrrolidin-1-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide (PubChem CID 95576076) has the molecular formula C20H28F2N2O2 and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-[(2R)-2-cyclohexylpyrrolidin-1-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-[(2R)-2-cyclohexylpyrrolidin-1-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 95576076 |
| Molecular Formula | C20H28F2N2O2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-[(2R)-2-cyclohexylpyrrolidin-1-yl]-N-[[4-(difluoromethoxy)phenyl]methyl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1C1CCCCC1)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H28F2N2O2/c21-20(22)26-17-10-8-15(9-11-17)13-23-19(25)14-24-12-4-7-18(24)16-5-2-1-3-6-16/h8-11,16,18,20H,1-7,12-14H2,(H,23,25)/t18-/m1/s1 |
| InChIKey | HJJCNFQVUNPCRM-GOSISDBHSA-N |
| XLogP | 3.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |