C15H20F2N2O3 — CID 110921510
N-[[4-(difluoromethoxy)phenyl]methyl]-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide (PubChem CID 110921510) has the molecular formula C15H20F2N2O3 and a molecular weight of 314.33 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110921510 |
| Molecular Formula | C15H20F2N2O3 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-2-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC[C@@H]1CO)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H20F2N2O3/c16-15(17)22-13-5-3-11(4-6-13)8-18-14(21)9-19-7-1-2-12(19)10-20/h3-6,12,15,20H,1-2,7-10H2,(H,18,21)/t12-/m1/s1 |
| InChIKey | SNGXCDFGAYLHGR-GFCCVEGCSA-N |
| XLogP | 1.36 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |