C15H19F2NO3 — CID 6363229
1-[4-(difluoromethoxy)phenyl]-2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethanone (PubChem CID 6363229) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 6363229 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCCC[C@@H]1CO)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H19F2NO3/c16-15(17)21-13-6-4-11(5-7-13)14(20)9-18-8-2-1-3-12(18)10-19/h4-7,12,15,19H,1-3,8-10H2/t12-/m1/s1 |
| InChIKey | RICZBJKYDZWQLM-GFCCVEGCSA-N |
| XLogP | 2.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |