C18H23ClF2N2O4 — CID 120680843
(3aS,6aR)-2-[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680843) has the molecular formula C18H23ClF2N2O4 and a molecular weight of 404.84 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680843 |
| Molecular Formula | C18H23ClF2N2O4 |
| Molecular Weight | 404.84 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (3aS,6aR)-2-[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H22F2N2O4.ClH/c19-17(20)26-14-5-3-12(4-6-14)8-21-15(23)10-22-9-13-2-1-7-18(13,11-22)16(24)25;/h3-6,13,17H,1-2,7-11H2,(H,21,23)(H,24,25);1H/t13-,18+;/m0./s1 |
| InChIKey | VBWKXQVZTYQTJH-UFRBEDTPSA-N |
| XLogP | 2.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |