C18H25ClN2O5 — CID 120681139
(3aS,6aR)-2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120681139) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120681139 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (3aS,6aR)-2-[2-(2,4-dimethoxyanilino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | COc1ccc(NC(=O)CN2C[C@@H]3CCC[C@@]3(C(=O)O)C2)c(OC)c1.Cl |
| InChI | InChI=1S/C18H24N2O5.ClH/c1-24-13-5-6-14(15(8-13)25-2)19-16(21)10-20-9-12-4-3-7-18(12,11-20)17(22)23;/h5-6,8,12H,3-4,7,9-11H2,1-2H3,(H,19,21)(H,22,23);1H/t12-,18+;/m0./s1 |
| InChIKey | ZFZQTSHGIDQHEG-MTGOSUSASA-N |
| XLogP | 2.25 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |