C20H28ClN3O5 — CID 120681387
(3aS,6aR)-2-[2-[[2-(2-methoxy-5-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120681387) has the molecular formula C20H28ClN3O5 and a molecular weight of 425.91 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[[2-(2-methoxy-5-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-[[2-(2-methoxy-5-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120681387 |
| Molecular Formula | C20H28ClN3O5 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (3aS,6aR)-2-[2-[[2-(2-methoxy-5-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | COc1ccc(C)cc1NC(=O)CNC(=O)CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1.Cl |
| InChI | InChI=1S/C20H27N3O5.ClH/c1-13-5-6-16(28-2)15(8-13)22-17(24)9-21-18(25)11-23-10-14-4-3-7-20(14,12-23)19(26)27;/h5-6,8,14H,3-4,7,9-12H2,1-2H3,(H,21,25)(H,22,24)(H,26,27);1H/t14-,20+;/m0./s1 |
| InChIKey | AEHRUMIGCCQEEZ-OWKALNPCSA-N |
| XLogP | 1.67 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |