C19H24ClN3O4 — CID 120681553
(3aS,6aR)-2-[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120681553) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120681553 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (3aS,6aR)-2-[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1c(Cl)cccc1NC(=O)CNC(=O)CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H24ClN3O4/c1-12-14(20)5-2-6-15(12)22-16(24)8-21-17(25)10-23-9-13-4-3-7-19(13,11-23)18(26)27/h2,5-6,13H,3-4,7-11H2,1H3,(H,21,25)(H,22,24)(H,26,27)/t13-,19+/m0/s1 |
| InChIKey | GDMCUHNUCXTFSP-ORAYPTAESA-N |
| XLogP | 1.89 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |