C22H25NO4S — CID 120679980
(3aS,6aR)-2-[[4-(4-methylphenyl)sulfonylphenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120679980) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is (3aS,6aR)-2-[[4-(4-methylphenyl)sulfonylphenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[[4-(4-methylphenyl)sulfonylphenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120679980 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3aS,6aR)-2-[[4-(4-methylphenyl)sulfonylphenyl]methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(CN3C[C@@H]4CCC[C@@]4(C(=O)O)C3)cc2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-16-4-8-19(9-5-16)28(26,27)20-10-6-17(7-11-20)13-23-14-18-3-2-12-22(18,15-23)21(24)25/h4-11,18H,2-3,12-15H2,1H3,(H,24,25)/t18-,22+/m0/s1 |
| InChIKey | NLRMHHWADHRPPL-PGRDOPGGSA-N |
| XLogP | 3.51 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |