C13H23ClN2O3 — CID 120680249
(3aS,6aR)-2-[2-oxo-2-(propan-2-ylamino)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680249) has the molecular formula C13H23ClN2O3 and a molecular weight of 290.79 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-oxo-2-(propan-2-ylamino)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-oxo-2-(propan-2-ylamino)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680249 |
| Molecular Formula | C13H23ClN2O3 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (3aS,6aR)-2-[2-oxo-2-(propan-2-ylamino)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | CC(C)NC(=O)CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1.Cl |
| InChI | InChI=1S/C13H22N2O3.ClH/c1-9(2)14-11(16)7-15-6-10-4-3-5-13(10,8-15)12(17)18;/h9-10H,3-8H2,1-2H3,(H,14,16)(H,17,18);1H/t10-,13+;/m0./s1 |
| InChIKey | PVVJIUPEBPAUDT-SMDQHNSPSA-N |
| XLogP | 1.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |