C21H32ClN3O4 — CID 120680990
(3aS,6aR)-2-[2-(1-adamantylcarbamoylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680990) has the molecular formula C21H32ClN3O4 and a molecular weight of 425.96 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(1-adamantylcarbamoylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-(1-adamantylcarbamoylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680990 |
| Molecular Formula | C21H32ClN3O4 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (3aS,6aR)-2-[2-(1-adamantylcarbamoylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H31N3O4.ClH/c25-17(11-24-10-16-2-1-3-21(16,12-24)18(26)27)22-19(28)23-20-7-13-4-14(8-20)6-15(5-13)9-20;/h13-16H,1-12H2,(H,26,27)(H2,22,23,25,28);1H/t13?,14?,15?,16-,20?,21+;/m0./s1 |
| InChIKey | VSSRCHDLFWZBQP-SPLTYANGSA-N |
| XLogP | 2.39 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |