C17H29ClN2O3 — CID 120681380
(3aS,6aR)-2-[2-(cycloheptylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120681380) has the molecular formula C17H29ClN2O3 and a molecular weight of 344.88 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(cycloheptylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-(cycloheptylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120681380 |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3aS,6aR)-2-[2-(cycloheptylamino)-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1)NC1CCCCCC1 |
| InChI | InChI=1S/C17H28N2O3.ClH/c20-15(18-14-7-3-1-2-4-8-14)11-19-10-13-6-5-9-17(13,12-19)16(21)22;/h13-14H,1-12H2,(H,18,20)(H,21,22);1H/t13-,17+;/m0./s1 |
| InChIKey | XGUVWBPQRVJVSY-OZIFAFRSSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |