C15H24N2O3 — CID 82363389
3-[2-(cyclohexylamino)-2-oxoethyl]-3-azabicyclo[4.1.0]heptane-1-carboxylic acid (PubChem CID 82363389) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-[2-(cyclohexylamino)-2-oxoethyl]-3-azabicyclo[4.1.0]heptane-1-carboxylic acid.
| Compound Name | 3-[2-(cyclohexylamino)-2-oxoethyl]-3-azabicyclo[4.1.0]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 82363389 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 3-[2-(cyclohexylamino)-2-oxoethyl]-3-azabicyclo[4.1.0]heptane-1-carboxylic acid |
| SMILES | O=C(CN1CCC2CC2(C(=O)O)C1)NC1CCCCC1 |
| InChI | InChI=1S/C15H24N2O3/c18-13(16-12-4-2-1-3-5-12)9-17-7-6-11-8-15(11,10-17)14(19)20/h11-12H,1-10H2,(H,16,18)(H,19,20) |
| InChIKey | CYPNULKIUKHMMT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |