C13H15ClF2N2O3 — CID 75451511
1-[4-chloro-3-(difluoromethoxy)phenyl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 75451511) has the molecular formula C13H15ClF2N2O3 and a molecular weight of 320.72 g/mol. Its IUPAC name is 1-[4-chloro-3-(difluoromethoxy)phenyl]-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[4-chloro-3-(difluoromethoxy)phenyl]-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 75451511 |
| Molecular Formula | C13H15ClF2N2O3 |
| Molecular Weight | 320.72 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 1-[4-chloro-3-(difluoromethoxy)phenyl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(Cl)c(OC(F)F)c1 |
| InChI | InChI=1S/C13H15ClF2N2O3/c14-10-4-3-8(6-11(10)21-12(15)16)18-13(19)17-7-9-2-1-5-20-9/h3-4,6,9,12H,1-2,5,7H2,(H2,17,18,19) |
| InChIKey | KPDKUUDDRCFMLC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |