C13H16F2N2O4S — CID 95185510
1-[3-(difluoromethylsulfonyl)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 95185510) has the molecular formula C13H16F2N2O4S and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-[3-(difluoromethylsulfonyl)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[3-(difluoromethylsulfonyl)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95185510 |
| Molecular Formula | C13H16F2N2O4S |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-[3-(difluoromethylsulfonyl)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCCO1)Nc1cccc(S(=O)(=O)C(F)F)c1 |
| InChI | InChI=1S/C13H16F2N2O4S/c14-12(15)22(19,20)11-5-1-3-9(7-11)17-13(18)16-8-10-4-2-6-21-10/h1,3,5,7,10,12H,2,4,6,8H2,(H2,16,17,18)/t10-/m0/s1 |
| InChIKey | WWRZCOLNFVDQIH-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |